CAS 1258626-21-9 is the registry number for 4-(2,4-Difluorophenyl)picolinic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-(2,4-difluorophenyl)pyridine-2-carboxylic acid (CAS 1258626-21-9) is a chemical compound with the molecular formula C12H7F2NO2 and a molecular weight of 235.19 g/mol. IUPAC name: 4-(2,4-difluorophenyl)pyridine-2-carboxylic acid. InChIKey: YWDILFQLNVGMGN-UHFFFAOYSA-N.
| Molecular formula | C12H7F2NO2 |
|---|---|
| Molecular weight | 235.19 g/mol |
| IUPAC name | 4-(2,4-difluorophenyl)pyridine-2-carboxylic acid |
| InChIKey | YWDILFQLNVGMGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C2=CC(=NC=C2)C(=O)O |
Computed by PubChem (NCBI)