Products 910301-32-5
CAS 910301-32-5 is the registry number for 1,3-Difluoro-5-(4-nitrophenyl)benzene, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,3-difluoro-5-(4-nitrophenyl)benzene (CAS 910301-32-5) is a chemical compound with the molecular formula C12H7F2NO2 and a molecular weight of 235.19 g/mol. IUPAC name: 1,3-difluoro-5-(4-nitrophenyl)benzene. InChIKey: FQUXUZXTMUTJEE-UHFFFAOYSA-N.
| Molecular formula | C12H7F2NO2 |
|---|---|
| Molecular weight | 235.19 g/mol |
| IUPAC name | 1,3-difluoro-5-(4-nitrophenyl)benzene |
| InChIKey | FQUXUZXTMUTJEE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)