CAS 1261947-80-1 is the registry number for 5-(2,5-Difluorophenyl)picolinic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 100mg.
5-(2,5-difluorophenyl)pyridine-2-carboxylic acid (CAS 1261947-80-1) is a chemical compound with the molecular formula C12H7F2NO2 and a molecular weight of 235.19 g/mol. IUPAC name: 5-(2,5-difluorophenyl)pyridine-2-carboxylic acid. InChIKey: YYSUWABBJBNJIL-UHFFFAOYSA-N.
| Molecular formula | C12H7F2NO2 |
|---|---|
| Molecular weight | 235.19 g/mol |
| IUPAC name | 5-(2,5-difluorophenyl)pyridine-2-carboxylic acid |
| InChIKey | YYSUWABBJBNJIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C2=CN=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)