Products 505082-74-6

CAS 505082-74-6 is the registry number for 6-(2,4-Difluorophenyl)nicotinic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

6-(2,4-difluorophenyl)pyridine-3-carboxylic acid (CAS 505082-74-6) is a chemical compound with the molecular formula C12H7F2NO2 and a molecular weight of 235.19 g/mol. IUPAC name: 6-(2,4-difluorophenyl)pyridine-3-carboxylic acid. InChIKey: PFOATVDDIXDITI-UHFFFAOYSA-N.

Identity
Molecular formulaC12H7F2NO2
Molecular weight235.19 g/mol
IUPAC name6-(2,4-difluorophenyl)pyridine-3-carboxylic acid
InChIKeyPFOATVDDIXDITI-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)F)C2=NC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)