Products 1258627-10-9

CAS 1258627-10-9 is the registry number for 2-(2,4-Difluorophenyl)isonicotinic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(2,4-difluorophenyl)pyridine-4-carboxylic acid (CAS 1258627-10-9) is a chemical compound with the molecular formula C12H7F2NO2 and a molecular weight of 235.19 g/mol. IUPAC name: 2-(2,4-difluorophenyl)pyridine-4-carboxylic acid. InChIKey: LCOCFESZSLZYAV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H7F2NO2
Molecular weight235.19 g/mol
IUPAC name2-(2,4-difluorophenyl)pyridine-4-carboxylic acid
InChIKeyLCOCFESZSLZYAV-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)F)C2=NC=CC(=C2)C(=O)O

Computed by PubChem (NCBI)