CAS 1258638-37-7 appears in our catalog under these names: 6-Methoxy-1,2-dihydrospiro[indole-3,4'-piperidine]-2-one, 95%, 6-Methoxyspiro(indoline-3,4'-piperidin)-2-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
6-methoxyspiro[1H-indole-3,4'-piperidine]-2-one (CAS 1258638-37-7) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: 6-methoxyspiro[1H-indole-3,4'-piperidine]-2-one. InChIKey: LDNJOARTTIDOGD-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | 6-methoxyspiro[1H-indole-3,4'-piperidine]-2-one |
| InChIKey | LDNJOARTTIDOGD-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3(CCNCC3)C(=O)N2 |
Computed by PubChem (NCBI)