CAS 1258650-52-0 is the registry number for {1-(4-(Propan-2-yl)phenyl)ethyl}hydrazine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(4-propan-2-ylphenyl)ethylhydrazine;hydrochloride (CAS 1258650-52-0) is a chemical compound with the molecular formula C11H19ClN2 and a molecular weight of 214.73 g/mol. IUPAC name: 1-(4-propan-2-ylphenyl)ethylhydrazine;hydrochloride. InChIKey: YUBROWRUJJXPPP-UHFFFAOYSA-N.
| Molecular formula | C11H19ClN2 |
|---|---|
| Molecular weight | 214.73 g/mol |
| IUPAC name | 1-(4-propan-2-ylphenyl)ethylhydrazine;hydrochloride |
| InChIKey | YUBROWRUJJXPPP-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C(C)NN.Cl |
Computed by PubChem (NCBI)