CAS 2051-79-8 appears in our catalog under these names: 4-(N,N-Diethyl)-2-methyl-p-phenylenediamine Monohydrochloride, 2–Amino–5–(diethylamino)toluene Monohydrochloride, 2-Amino-5-(diethylamino)toluene Monohydrochloride, >98.0%(HPLC)(T), 2-Amino-5-(diethylamino)toluene hydrochloride 98%, N1,N1-Diethyl-2-methylbenzene-1,4-diamine hydrochloride, 98%, 98%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 10g, 1g, 5g, 100g, 500g, 25g, 100MG.
4-N,4-N-diethyl-2-methylbenzene-1,4-diamine;hydrochloride (CAS 2051-79-8) is a chemical compound with the molecular formula C11H19ClN2 and a molecular weight of 214.73 g/mol. IUPAC name: 4-N,4-N-diethyl-2-methylbenzene-1,4-diamine;hydrochloride. InChIKey: MPLZNPZPPXERDA-UHFFFAOYSA-N.
| Molecular formula | C11H19ClN2 |
|---|---|
| Molecular weight | 214.73 g/mol |
| IUPAC name | 4-N,4-N-diethyl-2-methylbenzene-1,4-diamine;hydrochloride |
| InChIKey | MPLZNPZPPXERDA-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC(=C(C=C1)N)C.Cl |
Computed by PubChem (NCBI)