CAS 220844-81-5 is the registry number for 4-Amino-n-ethyl-n-isopropylaniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4-N-ethyl-4-N-propan-2-ylbenzene-1,4-diamine;hydrochloride (CAS 220844-81-5) is a chemical compound with the molecular formula C11H19ClN2 and a molecular weight of 214.73 g/mol. IUPAC name: 4-N-ethyl-4-N-propan-2-ylbenzene-1,4-diamine;hydrochloride. InChIKey: MRSCGJRIQPNDKW-UHFFFAOYSA-N.
| Molecular formula | C11H19ClN2 |
|---|---|
| Molecular weight | 214.73 g/mol |
| IUPAC name | 4-N-ethyl-4-N-propan-2-ylbenzene-1,4-diamine;hydrochloride |
| InChIKey | MRSCGJRIQPNDKW-UHFFFAOYSA-N |
| SMILES | CCN(C1=CC=C(C=C1)N)C(C)C.Cl |
Computed by PubChem (NCBI)