CAS 24828-38-4 appears in our catalog under these names: N1,N1-Diethyl-3-methylbenzene-1,4-diamine xhydrochloride, 98%, N4,N4-diethyl-2-methyl-1,4-Benzenediamine hydrochloride, 98%, 98%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 25g, 100g, 500g, 1kg.
4-N,4-N-diethyl-2-methylbenzene-1,4-diamine;hydrochloride (CAS 24828-38-4) is a chemical compound with the molecular formula C11H19ClN2 and a molecular weight of 214.73 g/mol. IUPAC name: 4-N,4-N-diethyl-2-methylbenzene-1,4-diamine;hydrochloride. InChIKey: MPLZNPZPPXERDA-UHFFFAOYSA-N.
| Molecular formula | C11H19ClN2 |
|---|---|
| Molecular weight | 214.73 g/mol |
| IUPAC name | 4-N,4-N-diethyl-2-methylbenzene-1,4-diamine;hydrochloride |
| InChIKey | MPLZNPZPPXERDA-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC(=C(C=C1)N)C.Cl |
Computed by PubChem (NCBI)