CAS 91215-79-1 appears in our catalog under these names: N-ETHYL-N-ISOPROPYL-P-PHENYLENEDIAMINE &, N1-ethyl-N1-(propan-2-yl)benzene-1,4-diamine. Offered by: Sigma-Aldrich, Chemat. Available pack sizes: 25G.
4-N-ethyl-4-N-propan-2-ylbenzene-1,4-diamine;hydrochloride (CAS 91215-79-1) is a chemical compound with the molecular formula C11H19ClN2 and a molecular weight of 214.73 g/mol. IUPAC name: 4-N-ethyl-4-N-propan-2-ylbenzene-1,4-diamine;hydrochloride. InChIKey: MRSCGJRIQPNDKW-UHFFFAOYSA-N.
| Molecular formula | C11H19ClN2 |
|---|---|
| Molecular weight | 214.73 g/mol |
| IUPAC name | 4-N-ethyl-4-N-propan-2-ylbenzene-1,4-diamine;hydrochloride |
| InChIKey | MRSCGJRIQPNDKW-UHFFFAOYSA-N |
| SMILES | CCN(C1=CC=C(C=C1)N)C(C)C.Cl |
Computed by PubChem (NCBI)