Products 1258980-24-3

CAS 1258980-24-3 is the registry number for Amisulpride Impurity 15. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 4-amino-5-ethylsulfonyl-2-methoxybenzoate (CAS 1258980-24-3) is a chemical compound with the molecular formula C12H17NO5S and a molecular weight of 287.33 g/mol. IUPAC name: ethyl 4-amino-5-ethylsulfonyl-2-methoxybenzoate. InChIKey: XTWSJLOVAZOXHI-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17NO5S
Molecular weight287.33 g/mol
IUPAC nameethyl 4-amino-5-ethylsulfonyl-2-methoxybenzoate
InChIKeyXTWSJLOVAZOXHI-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=C(C=C1OC)N)S(=O)(=O)CC

Computed by PubChem (NCBI)