CAS 1259224-03-7 is the registry number for 1,3,5-Trichloroisoquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3,5-trichloroisoquinoline (CAS 1259224-03-7) is a chemical compound with the molecular formula C9H4Cl3N and a molecular weight of 232.5 g/mol. IUPAC name: 1,3,5-trichloroisoquinoline. InChIKey: WPPQZTYPZHJJTO-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl3N |
|---|---|
| Molecular weight | 232.5 g/mol |
| IUPAC name | 1,3,5-trichloroisoquinoline |
| InChIKey | WPPQZTYPZHJJTO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C(C=C2C(=C1)Cl)Cl)Cl |
Computed by PubChem (NCBI)