CAS 855763-24-5 appears in our catalog under these names: 4,5,8-Trichloroquinoline, 95%, 4,5,8-Trichloroquinoline, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 500mg.
4,5,8-trichloroquinoline (CAS 855763-24-5) is a chemical compound with the molecular formula C9H4Cl3N and a molecular weight of 232.5 g/mol. IUPAC name: 4,5,8-trichloroquinoline. InChIKey: YHGCMJPZRPMARL-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl3N |
|---|---|
| Molecular weight | 232.5 g/mol |
| IUPAC name | 4,5,8-trichloroquinoline |
| InChIKey | YHGCMJPZRPMARL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Cl)C(=CC=N2)Cl)Cl |
Computed by PubChem (NCBI)