Products 1053658-49-3
CAS 1053658-49-3 appears in our catalog under these names: 1,3,6-Trichloroisoquinoline, 1,3,6-Trichloroisoquinoline 95%, 1,3,6-Trichloroisoquinoline, 97%. Offered by: Biosynth, Ambeed, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 1g, 5g.
1,3,6-trichloroisoquinoline (CAS 1053658-49-3) is a chemical compound with the molecular formula C9H4Cl3N and a molecular weight of 232.5 g/mol. IUPAC name: 1,3,6-trichloroisoquinoline. InChIKey: IQEHNPFLYOSKCB-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl3N |
|---|---|
| Molecular weight | 232.5 g/mol |
| IUPAC name | 1,3,6-trichloroisoquinoline |
| InChIKey | IQEHNPFLYOSKCB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C(C=C2C=C1Cl)Cl)Cl |
Computed by PubChem (NCBI)