CAS 1341345-20-7 appears in our catalog under these names: 2,7,8-Trichloroquinoline, 95%, 2,7,8-Trichloroquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2,7,8-trichloroquinoline (CAS 1341345-20-7) is a chemical compound with the molecular formula C9H4Cl3N and a molecular weight of 232.5 g/mol. IUPAC name: 2,7,8-trichloroquinoline. InChIKey: GMWMBZACFDXEKV-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl3N |
|---|---|
| Molecular weight | 232.5 g/mol |
| IUPAC name | 2,7,8-trichloroquinoline |
| InChIKey | GMWMBZACFDXEKV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=CC(=N2)Cl)Cl)Cl |
Computed by PubChem (NCBI)