CAS 153749-72-5 appears in our catalog under these names: 2,4,5–Trichloroquinoline, 2,4,5-Trichloroquinoline 98%, 2,4,5-Trichloroquinoline, 98%, 98%, 2,4,5-Trichloroquinoline, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
2,4,5-trichloroquinoline (CAS 153749-72-5) is a chemical compound with the molecular formula C9H4Cl3N and a molecular weight of 232.5 g/mol. IUPAC name: 2,4,5-trichloroquinoline. InChIKey: PVOFTAIVWVOBGR-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl3N |
|---|---|
| Molecular weight | 232.5 g/mol |
| IUPAC name | 2,4,5-trichloroquinoline |
| InChIKey | PVOFTAIVWVOBGR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)