CAS 25771-77-1 appears in our catalog under these names: 3,4,8-Trichloroquinoline, 95+%, 3，4，8–Trichloro–quinoline. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
3,4,8-trichloroquinoline (CAS 25771-77-1) is a chemical compound with the molecular formula C9H4Cl3N and a molecular weight of 232.5 g/mol. IUPAC name: 3,4,8-trichloroquinoline. InChIKey: MWSSGTREQLOARH-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl3N |
|---|---|
| Molecular weight | 232.5 g/mol |
| IUPAC name | 3,4,8-trichloroquinoline |
| InChIKey | MWSSGTREQLOARH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN=C2C(=C1)Cl)Cl)Cl |
Computed by PubChem (NCBI)