Products 1259594-36-9
CAS 1259594-36-9 is the registry number for (S)-5-Chloro-4-fluoro-2,3-dihydro-1H-inden-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-5-chloro-4-fluoro-2,3-dihydro-1H-inden-1-amine (CAS 1259594-36-9) is a chemical compound with the molecular formula C9H9ClFN and a molecular weight of 185.62 g/mol. IUPAC name: (1S)-5-chloro-4-fluoro-2,3-dihydro-1H-inden-1-amine. InChIKey: DDJFAJYGEOBOSM-QMMMGPOBSA-N.
| Molecular formula | C9H9ClFN |
|---|---|
| Molecular weight | 185.62 g/mol |
| IUPAC name | (1S)-5-chloro-4-fluoro-2,3-dihydro-1H-inden-1-amine |
| InChIKey | DDJFAJYGEOBOSM-QMMMGPOBSA-N |
| SMILES | C1CC2=C([C@H]1N)C=CC(=C2F)Cl |
Computed by PubChem (NCBI)