Products 1259759-12-0
CAS 1259759-12-0 is the registry number for (R)-6,7-Difluoro-2,3-dihydrobenzofuran-3-amine, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(3R)-6,7-difluoro-2,3-dihydro-1-benzofuran-3-amine (CAS 1259759-12-0) is a chemical compound with the molecular formula C8H7F2NO and a molecular weight of 171.14 g/mol. IUPAC name: (3R)-6,7-difluoro-2,3-dihydro-1-benzofuran-3-amine. InChIKey: ANFLWYDAQMRUMC-LURJTMIESA-N.
| Molecular formula | C8H7F2NO |
|---|---|
| Molecular weight | 171.14 g/mol |
| IUPAC name | (3R)-6,7-difluoro-2,3-dihydro-1-benzofuran-3-amine |
| InChIKey | ANFLWYDAQMRUMC-LURJTMIESA-N |
| SMILES | C1[C@@H](C2=C(O1)C(=C(C=C2)F)F)N |
Computed by PubChem (NCBI)