Products 1260008-48-7
CAS 1260008-48-7 appears in our catalog under these names: 7-Chloro-5-fluoro-2,3-dihydro-1H-inden-1-one, 97%, 97%, 1H-Inden-1-one, 7-chloro-5-fluoro-2,3-dihydro-, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
7-chloro-5-fluoro-2,3-dihydroinden-1-one (CAS 1260008-48-7) is a chemical compound with the molecular formula C9H6ClFO and a molecular weight of 184.59 g/mol. IUPAC name: 7-chloro-5-fluoro-2,3-dihydroinden-1-one. InChIKey: NMXMPCZIVXSMSO-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFO |
|---|---|
| Molecular weight | 184.59 g/mol |
| IUPAC name | 7-chloro-5-fluoro-2,3-dihydroinden-1-one |
| InChIKey | NMXMPCZIVXSMSO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=C(C=C2Cl)F |
Computed by PubChem (NCBI)