CAS 1260013-11-3 appears in our catalog under these names: 5–Chloro–4–fluoro–2,3–dihydro–1H–inden–1–one, 5-Chloro-4-fluoro-2,3-dihydro-1H-inden-1-one, 5-Chloro-4-fluoro-2,3-dihydro-1H-inden-1-one, 97%, 97%, 5-CHLORO-4-FLUORO-2,3-DIHYDRO-1H-INDEN-1-ONE, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 2,5g, 10g, 25g.
5-chloro-4-fluoro-2,3-dihydroinden-1-one (CAS 1260013-11-3) is a chemical compound with the molecular formula C9H6ClFO and a molecular weight of 184.59 g/mol. IUPAC name: 5-chloro-4-fluoro-2,3-dihydroinden-1-one. InChIKey: VRURYMJQFZRENG-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFO |
|---|---|
| Molecular weight | 184.59 g/mol |
| IUPAC name | 5-chloro-4-fluoro-2,3-dihydroinden-1-one |
| InChIKey | VRURYMJQFZRENG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=C(C=C2)Cl)F |
Computed by PubChem (NCBI)