CAS 1260092-44-1 appears in our catalog under these names: Boc–NH–PEG1–CH2CH2COOH, 3-[2-[(tert-Butoxycarbonyl)amino]ethoxy]propanoic Acid, >93.0%(GC)(T), 3-(2-{((tert-butoxy)carbonyl)amino}ethoxy)propanoic acid, Boc-PEG1-CH2CH2COOH 95%, 3-(2-((tert-Butoxycarbonyl)amino)ethoxy)propanoic acid, 97%, 97%. Offered by: GLPBio, TCI, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 500mg, 10g, 100mg, 1g, 5g, 25g, 100g.
3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]propanoic acid (CAS 1260092-44-1) is a chemical compound with the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. IUPAC name: 3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]propanoic acid. InChIKey: YGNSGMAPLOVGIU-UHFFFAOYSA-N.
| Molecular formula | C10H19NO5 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | 3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]propanoic acid |
| InChIKey | YGNSGMAPLOVGIU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCC(=O)O |
Computed by PubChem (NCBI)