Products 1260239-23-3
CAS 1260239-23-3 is the registry number for alpha-RA-F. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-3,5-dihydroxybenzamide (CAS 1260239-23-3) is a chemical compound with the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. IUPAC name: N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-3,5-dihydroxybenzamide. InChIKey: VIBGZWUSHYPKCT-AWEZNQCLSA-N.
| Molecular formula | C16H16N2O4 |
|---|---|
| Molecular weight | 300.31 g/mol |
| IUPAC name | N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-3,5-dihydroxybenzamide |
| InChIKey | VIBGZWUSHYPKCT-AWEZNQCLSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N)NC(=O)C2=CC(=CC(=C2)O)O |
Computed by PubChem (NCBI)