CAS 1260382-80-6 appears in our catalog under these names: Benzo[d]isothiazole-7-carboxylic acid, 95%, Benzo(d)isothiazole–7–carboxylic acid, 1,2-Benzothiazole-7-carboxylic acid. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 0,5g, 50mg.
1,2-benzothiazole-7-carboxylic acid (CAS 1260382-80-6) is a chemical compound with the molecular formula C8H5NO2S and a molecular weight of 179.20 g/mol. IUPAC name: 1,2-benzothiazole-7-carboxylic acid. InChIKey: VVUDWXMKSIIWHQ-UHFFFAOYSA-N.
| Molecular formula | C8H5NO2S |
|---|---|
| Molecular weight | 179.20 g/mol |
| IUPAC name | 1,2-benzothiazole-7-carboxylic acid |
| InChIKey | VVUDWXMKSIIWHQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)SN=C2 |
Computed by PubChem (NCBI)