Products 1260382-80-6

CAS 1260382-80-6 appears in our catalog under these names: Benzo[d]isothiazole-7-carboxylic acid, 95%, Benzo(d)isothiazole–7–carboxylic acid, 1,2-Benzothiazole-7-carboxylic acid. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1,2-benzothiazole-7-carboxylic acid (CAS 1260382-80-6) is a chemical compound with the molecular formula C8H5NO2S and a molecular weight of 179.20 g/mol. IUPAC name: 1,2-benzothiazole-7-carboxylic acid. InChIKey: VVUDWXMKSIIWHQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5NO2S
Molecular weight179.20 g/mol
IUPAC name1,2-benzothiazole-7-carboxylic acid
InChIKeyVVUDWXMKSIIWHQ-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)C(=O)O)SN=C2

Computed by PubChem (NCBI)