CAS 1260382-87-3 appears in our catalog under these names: 4-Bromo-2-methyl-1h-indole-6-carboxylic acid, 95%, 4-Bromo-2-methyl-1H-indole-6-carboxylic acid, 97%, 4-bromo-2-methyl-1H-indole-6-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg.
4-bromo-2-methyl-1H-indole-6-carboxylic acid (CAS 1260382-87-3) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 4-bromo-2-methyl-1H-indole-6-carboxylic acid. InChIKey: PGLGZKNSGVBDGQ-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 4-bromo-2-methyl-1H-indole-6-carboxylic acid |
| InChIKey | PGLGZKNSGVBDGQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1)C=C(C=C2Br)C(=O)O |
Computed by PubChem (NCBI)