CAS 1260519-71-8 is the registry number for 3-Chloro-2-methylpyrido(2,3-b)pyrazine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-chloro-2-methylpyrido[2,3-b]pyrazine (CAS 1260519-71-8) is a chemical compound with the molecular formula C8H6ClN3 and a molecular weight of 179.60 g/mol. IUPAC name: 3-chloro-2-methylpyrido[2,3-b]pyrazine. InChIKey: YARAETSZJAIRCE-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3 |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 3-chloro-2-methylpyrido[2,3-b]pyrazine |
| InChIKey | YARAETSZJAIRCE-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2C(=N1)C=CC=N2)Cl |
Computed by PubChem (NCBI)