CAS 1260529-67-6 appears in our catalog under these names: 4-Benzothiazolecarboxylic acid, 95%, Benzo(d)thiazole-4-carboxylic acid, 97%, Benzo(d)thiazole-4-carboxylic acid, Benzo[d]thiazole-4-carboxylic acid, 95%, 95%, BENZO[D]THIAZOLE-4-CARBOXYLIC ACID, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 100mg, 5g.
1,3-benzothiazole-4-carboxylic acid (CAS 1260529-67-6) is a chemical compound with the molecular formula C8H5NO2S and a molecular weight of 179.20 g/mol. IUPAC name: 1,3-benzothiazole-4-carboxylic acid. InChIKey: XBFRQODQXBMILB-UHFFFAOYSA-N.
| Molecular formula | C8H5NO2S |
|---|---|
| Molecular weight | 179.20 g/mol |
| IUPAC name | 1,3-benzothiazole-4-carboxylic acid |
| InChIKey | XBFRQODQXBMILB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)SC=N2)C(=O)O |
Computed by PubChem (NCBI)