CAS 1260588-00-8 appears in our catalog under these names: (3R)-3-{((tert-butoxy)carbonyl)amino}-3-cyclopropylpropanoic acid, 97%, (R)-3-((tert-Butoxycarbonyl)amino)-3-cyclopropylpropanoic acid, (3R)-3-{[(tert-butoxy)carbonyl]amino}-3-cyclopropylpropanoic acid, 97%, 97%, (R)-3-((tert-butoxycarbonyl)amino)-3-cyclopropylpropanoic acid, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 0,5g, 50mg, 100mg, 250mg, 500mg.
(3R)-3-cyclopropyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1260588-00-8) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: (3R)-3-cyclopropyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: VGEUFFPHZNVSKU-MRVPVSSYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | (3R)-3-cyclopropyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | VGEUFFPHZNVSKU-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)C1CC1 |
Computed by PubChem (NCBI)