CAS 683218-80-6 appears in our catalog under these names: 3-[(tert-Butoxycarbonyl)amino]-3-cyclopropylpropanoic acid, 97%, 3–(Boc–amino)–3–cyclopropylpropanoic Acid, 3-(Boc-amino)-3-cyclopropylpropanoic acid, 3-((tert-Butoxycarbonyl)amino)-3-cyclopropylpropanoic acid, 97%, 97%, 3-((tert-Butoxycarbonyl)amino)-3-cyclopropylpropanoic acid, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 100mg, 250mg.
3-cyclopropyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 683218-80-6) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: 3-cyclopropyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: VGEUFFPHZNVSKU-UHFFFAOYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 3-cyclopropyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | VGEUFFPHZNVSKU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)C1CC1 |
Computed by PubChem (NCBI)