CAS 1260591-69-2 is the registry number for (2S,3S)-1-Benzyloxycarbonyl-2-methyl-piperidine-3-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(2S,3S)-2-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid (CAS 1260591-69-2) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: (2S,3S)-2-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid. InChIKey: QQCOVXZKKNSHFI-AAEUAGOBSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | (2S,3S)-2-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid |
| InChIKey | QQCOVXZKKNSHFI-AAEUAGOBSA-N |
| SMILES | C[C@H]1[C@H](CCCN1C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)