Products 1871579-06-4

CAS 1871579-06-4 is the registry number for 1-((Benzyloxy)carbonyl)-2-methylpiperidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

2-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid (CAS 1871579-06-4) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: 2-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid. InChIKey: QQCOVXZKKNSHFI-UHFFFAOYSA-N.

Identity
Molecular formulaC15H19NO4
Molecular weight277.31 g/mol
IUPAC name2-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid
InChIKeyQQCOVXZKKNSHFI-UHFFFAOYSA-N
SMILESCC1C(CCCN1C(=O)OCC2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)