Products 1260640-88-7
CAS 1260640-88-7 is the registry number for 3-(Benzyloxy)-3-oxo-2-(quinolin-4-ylmethyl)propanoic acid, 95%. Offered by: Chemat. Available pack sizes: 1g.
3-oxo-3-phenylmethoxy-2-(quinolin-4-ylmethyl)propanoic acid (CAS 1260640-88-7) is a chemical compound with the molecular formula C20H17NO4 and a molecular weight of 335.4 g/mol. IUPAC name: 3-oxo-3-phenylmethoxy-2-(quinolin-4-ylmethyl)propanoic acid. InChIKey: BOBHRHQCEKNERT-UHFFFAOYSA-N.
| Molecular formula | C20H17NO4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 3-oxo-3-phenylmethoxy-2-(quinolin-4-ylmethyl)propanoic acid |
| InChIKey | BOBHRHQCEKNERT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C(CC2=CC=NC3=CC=CC=C23)C(=O)O |
Computed by PubChem (NCBI)