Products 1260643-32-0
CAS 1260643-32-0 is the registry number for 6-Bromo-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid, 95%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 250mg, 100mg, 1g.
6-bromo-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid (CAS 1260643-32-0) is a chemical compound with the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. IUPAC name: 6-bromo-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid. InChIKey: LOEFNPKFRHLLSR-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2 |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 6-bromo-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid |
| InChIKey | LOEFNPKFRHLLSR-UHFFFAOYSA-N |
| SMILES | C1CNC(C2=C1C=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)