Products 1260653-10-8
CAS 1260653-10-8 is the registry number for 1-(3-(Trifluoromethoxy)phenyl)cyclopropane-1-carbonitrile. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-[3-(trifluoromethoxy)phenyl]cyclopropane-1-carbonitrile (CAS 1260653-10-8) is a chemical compound with the molecular formula C11H8F3NO and a molecular weight of 227.18 g/mol. IUPAC name: 1-[3-(trifluoromethoxy)phenyl]cyclopropane-1-carbonitrile. InChIKey: BENIAMBYUGNOCH-UHFFFAOYSA-N.
| Molecular formula | C11H8F3NO |
|---|---|
| Molecular weight | 227.18 g/mol |
| IUPAC name | 1-[3-(trifluoromethoxy)phenyl]cyclopropane-1-carbonitrile |
| InChIKey | BENIAMBYUGNOCH-UHFFFAOYSA-N |
| SMILES | C1CC1(C#N)C2=CC(=CC=C2)OC(F)(F)F |
Computed by PubChem (NCBI)