CAS 1260669-99-5 is the registry number for 2-Bromo-1-{2H-(1,3)dioxolo(4,5-b)pyridin-6-yl}ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-bromo-1-([1,3]dioxolo[4,5-b]pyridin-6-yl)ethanone (CAS 1260669-99-5) is a chemical compound with the molecular formula C8H6BrNO3 and a molecular weight of 244.04 g/mol. IUPAC name: 2-bromo-1-([1,3]dioxolo[4,5-b]pyridin-6-yl)ethanone. InChIKey: GWHBJOITQQLVAF-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO3 |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | 2-bromo-1-([1,3]dioxolo[4,5-b]pyridin-6-yl)ethanone |
| InChIKey | GWHBJOITQQLVAF-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)N=CC(=C2)C(=O)CBr |
Computed by PubChem (NCBI)