Products 1260763-01-6
CAS 1260763-01-6 is the registry number for 2-Bromo-6-(4-methyl-1-piperazinyl)benzonitrile, 95% . Offered by: Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 250mg.
2-bromo-6-(4-methylpiperazin-1-yl)benzonitrile (CAS 1260763-01-6) is a chemical compound with the molecular formula C12H14BrN3 and a molecular weight of 280.16 g/mol. IUPAC name: 2-bromo-6-(4-methylpiperazin-1-yl)benzonitrile. InChIKey: XDFWUVBVNHLPIB-UHFFFAOYSA-N.
| Molecular formula | C12H14BrN3 |
|---|---|
| Molecular weight | 280.16 g/mol |
| IUPAC name | 2-bromo-6-(4-methylpiperazin-1-yl)benzonitrile |
| InChIKey | XDFWUVBVNHLPIB-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C(=CC=C2)Br)C#N |
Computed by PubChem (NCBI)