Products 1260806-33-4
CAS 1260806-33-4 is the registry number for Ethyl 2-(2-((tert-butoxycarbonyl)amino)pyridin-3-yl)-2-oxoacetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]-2-oxoacetate (CAS 1260806-33-4) is a chemical compound with the molecular formula C14H18N2O5 and a molecular weight of 294.30 g/mol. IUPAC name: ethyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]-2-oxoacetate. InChIKey: IHKVJXUVROKCCI-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O5 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | ethyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]-2-oxoacetate |
| InChIKey | IHKVJXUVROKCCI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=C(N=CC=C1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)