Products 1260807-49-5
CAS 1260807-49-5 appears in our catalog under these names: tert–Butyl 3–bromopicolinate, tert-Butyl 3-bromopicolinate 97%, tert-Butyl 3-bromopicolinate, 97%, 97%, tert-Butyl 3-bromopicolinate, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100g.
Tert-butyl 3-bromopyridine-2-carboxylate (CAS 1260807-49-5) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: tert-butyl 3-bromopyridine-2-carboxylate. InChIKey: BQXZWVWSJGWASF-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | tert-butyl 3-bromopyridine-2-carboxylate |
| InChIKey | BQXZWVWSJGWASF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=CC=N1)Br |
Computed by PubChem (NCBI)