CAS 1260839-35-7 is the registry number for 3-(Trifluoromethyl)benzo[d]isoxazol-5-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(trifluoromethyl)-1,2-benzoxazol-5-ol (CAS 1260839-35-7) is a chemical compound with the molecular formula C8H4F3NO2 and a molecular weight of 203.12 g/mol. IUPAC name: 3-(trifluoromethyl)-1,2-benzoxazol-5-ol. InChIKey: SIRGERVMEXWKFP-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO2 |
|---|---|
| Molecular weight | 203.12 g/mol |
| IUPAC name | 3-(trifluoromethyl)-1,2-benzoxazol-5-ol |
| InChIKey | SIRGERVMEXWKFP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C(=NO2)C(F)(F)F |
Computed by PubChem (NCBI)