CAS 182500-26-1 appears in our catalog under these names: 1-Isocyanato-2-trifluoromethoxy-benzene, 95%, 2-(Trifluoromethoxy)phenyl Isocyanate, >98.0%(GC), 2-Trifluoromethoxyphenylisocyanate 95%. Offered by: Fluorochem, TCI, Ambeed. Available pack sizes: 1g, 5g, 25g.
1-isocyanato-2-(trifluoromethoxy)benzene (CAS 182500-26-1) is a chemical compound with the molecular formula C8H4F3NO2 and a molecular weight of 203.12 g/mol. IUPAC name: 1-isocyanato-2-(trifluoromethoxy)benzene. InChIKey: CTMGYQHKKIEXKF-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO2 |
|---|---|
| Molecular weight | 203.12 g/mol |
| IUPAC name | 1-isocyanato-2-(trifluoromethoxy)benzene |
| InChIKey | CTMGYQHKKIEXKF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N=C=O)OC(F)(F)F |
Computed by PubChem (NCBI)