CAS 55225-86-0 appears in our catalog under these names: 3-(Trifluoromethoxy)phenyl isocyanate, 95%, 1-Isocyanato-3-(trifluoromethoxy)benzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 2,5g.
1-isocyanato-3-(trifluoromethoxy)benzene (CAS 55225-86-0) is a chemical compound with the molecular formula C8H4F3NO2 and a molecular weight of 203.12 g/mol. IUPAC name: 1-isocyanato-3-(trifluoromethoxy)benzene. InChIKey: OKJYBJOTWLVTAO-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO2 |
|---|---|
| Molecular weight | 203.12 g/mol |
| IUPAC name | 1-isocyanato-3-(trifluoromethoxy)benzene |
| InChIKey | OKJYBJOTWLVTAO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)N=C=O |
Computed by PubChem (NCBI)