CAS 1806520-96-6 appears in our catalog under these names: 6-(trifluoromethyl)-2,3-dihydro-1,3-benzoxazol-2-one, 96%, 96%, 6-(Trifluoromethyl)benzo[d]oxazol-2(3H)-one, 98%. Offered by: Chemat, Chemat Brand. Available pack sizes: 100mg, 250mg, 500mg, 1g, on request.
6-(trifluoromethyl)-3H-1,3-benzoxazol-2-one (CAS 1806520-96-6) is a chemical compound with the molecular formula C8H4F3NO2 and a molecular weight of 203.12 g/mol. IUPAC name: 6-(trifluoromethyl)-3H-1,3-benzoxazol-2-one. InChIKey: KZXDHIAHJFPLJS-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO2 |
|---|---|
| Molecular weight | 203.12 g/mol |
| IUPAC name | 6-(trifluoromethyl)-3H-1,3-benzoxazol-2-one |
| InChIKey | KZXDHIAHJFPLJS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)OC(=O)N2 |
Computed by PubChem (NCBI)