CAS 1804033-60-0 is the registry number for 7-(Trifluoromethyl)benzo[d]oxazol-2-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-(trifluoromethyl)-3H-1,3-benzoxazol-2-one (CAS 1804033-60-0) is a chemical compound with the molecular formula C8H4F3NO2 and a molecular weight of 203.12 g/mol. IUPAC name: 7-(trifluoromethyl)-3H-1,3-benzoxazol-2-one. InChIKey: JZAJARHISAANPC-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO2 |
|---|---|
| Molecular weight | 203.12 g/mol |
| IUPAC name | 7-(trifluoromethyl)-3H-1,3-benzoxazol-2-one |
| InChIKey | JZAJARHISAANPC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NC(=O)O2)C(F)(F)F |
Computed by PubChem (NCBI)