CAS 1260884-97-6 appears in our catalog under these names: 4-(Chloromethyl)-2-fluoro-1-nitrobenzene, 97%, 4-(Chloromethyl)-2-fluoro-1-nitrobenzene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(chloromethyl)-2-fluoro-1-nitrobenzene (CAS 1260884-97-6) is a chemical compound with the molecular formula C7H5ClFNO2 and a molecular weight of 189.57 g/mol. IUPAC name: 4-(chloromethyl)-2-fluoro-1-nitrobenzene. InChIKey: OBWIVHSCVRIOAA-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO2 |
|---|---|
| Molecular weight | 189.57 g/mol |
| IUPAC name | 4-(chloromethyl)-2-fluoro-1-nitrobenzene |
| InChIKey | OBWIVHSCVRIOAA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CCl)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)