CAS 1261061-19-1 is the registry number for (S)-7,8,9,10-Tetrahydro-5h-pyrido[1,2-a]quinoxalin-6(6ah)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(6aS)-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-6-one (CAS 1261061-19-1) is a chemical compound with the molecular formula C12H14N2O and a molecular weight of 202.25 g/mol. IUPAC name: (6aS)-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-6-one. InChIKey: BPTLVNXOZVWAGH-NSHDSACASA-N.
| Molecular formula | C12H14N2O |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | (6aS)-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-6-one |
| InChIKey | BPTLVNXOZVWAGH-NSHDSACASA-N |
| SMILES | C1CCN2[C@@H](C1)C(=O)NC3=CC=CC=C32 |
Computed by PubChem (NCBI)