CAS 89860-74-2 is the registry number for 5H,6H,6aH,7H,8H,9H,10H-Pyrido(1,2-a)quinoxalin-6-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-6-one (CAS 89860-74-2) is a chemical compound with the molecular formula C12H14N2O and a molecular weight of 202.25 g/mol. IUPAC name: 5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-6-one. InChIKey: BPTLVNXOZVWAGH-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | 5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-6-one |
| InChIKey | BPTLVNXOZVWAGH-UHFFFAOYSA-N |
| SMILES | C1CCN2C(C1)C(=O)NC3=CC=CC=C32 |
Computed by PubChem (NCBI)