CAS 1261219-83-3 appears in our catalog under these names: Indacaterol Impurity 19, Indacaterol Impurity 41. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-[(1R)-1,2-dihydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one (CAS 1261219-83-3) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 311.3 g/mol. IUPAC name: 5-[(1R)-1,2-dihydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one. InChIKey: SCBKORPITKACNB-HNNXBMFYSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | 5-[(1R)-1,2-dihydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one |
| InChIKey | SCBKORPITKACNB-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C3C(=C(C=C2)[C@H](CO)O)C=CC(=O)N3 |
Computed by PubChem (NCBI)