CAS 1823795-12-5 is the registry number for Indacaterol Impurity 71. Offered by: Chemat Brand. Available pack sizes: on request.
5-(1,2-dihydroxyethyl)-8-phenylmethoxy-1H-quinolin-2-one (CAS 1823795-12-5) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 311.3 g/mol. IUPAC name: 5-(1,2-dihydroxyethyl)-8-phenylmethoxy-1H-quinolin-2-one. InChIKey: SCBKORPITKACNB-UHFFFAOYSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | 5-(1,2-dihydroxyethyl)-8-phenylmethoxy-1H-quinolin-2-one |
| InChIKey | SCBKORPITKACNB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C3C(=C(C=C2)C(CO)O)C=CC(=O)N3 |
Computed by PubChem (NCBI)