CAS 1261235-73-7 is the registry number for 1-(2,4-Dichloro-benzyl)-piperazine hydrochloride. Offered by: Biosynth. Available pack sizes: 25g, 10g.
1-[(2,4-dichlorophenyl)methyl]piperazine;hydrochloride (CAS 1261235-73-7) is a chemical compound with the molecular formula C11H15Cl3N2 and a molecular weight of 281.6 g/mol. IUPAC name: 1-[(2,4-dichlorophenyl)methyl]piperazine;hydrochloride. InChIKey: YIILZESPSVYOCC-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl3N2 |
|---|---|
| Molecular weight | 281.6 g/mol |
| IUPAC name | 1-[(2,4-dichlorophenyl)methyl]piperazine;hydrochloride |
| InChIKey | YIILZESPSVYOCC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=C(C=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)